Add windowskext integration, update related packages
This commit is contained in:
6
.gitignore
vendored
6
.gitignore
vendored
@@ -32,3 +32,9 @@ _testmain.go
|
||||
|
||||
# Output of the go coverage tool, specifically when used with LiteIDE
|
||||
*.out
|
||||
|
||||
# OS specifics
|
||||
.DS_Store
|
||||
|
||||
# Custom dev scripts
|
||||
win_dev_*
|
||||
|
||||
@@ -4,6 +4,7 @@ import (
|
||||
"fmt"
|
||||
"os"
|
||||
"os/signal"
|
||||
"runtime"
|
||||
"syscall"
|
||||
|
||||
"github.com/Safing/portbase/info"
|
||||
@@ -16,6 +17,8 @@ import (
|
||||
|
||||
func main() {
|
||||
|
||||
runtime.GOMAXPROCS(4)
|
||||
|
||||
// Set Info
|
||||
info.Set("Portmaster (DNS only)", "0.2.0", "AGPLv3", false)
|
||||
|
||||
@@ -25,10 +28,7 @@ func main() {
|
||||
if err == modules.ErrCleanExit {
|
||||
os.Exit(0)
|
||||
} else {
|
||||
err = modules.Shutdown()
|
||||
if err != nil {
|
||||
log.Shutdown()
|
||||
}
|
||||
modules.Shutdown()
|
||||
os.Exit(1)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -39,7 +39,7 @@ var (
|
||||
)
|
||||
|
||||
func init() {
|
||||
modules.Register("firewall", prep, start, stop, "core", "network", "nameserver", "profile")
|
||||
modules.Register("firewall", prep, start, stop, "core", "network", "nameserver", "profile", "updates")
|
||||
}
|
||||
|
||||
func prep() (err error) {
|
||||
@@ -91,26 +91,36 @@ func stop() error {
|
||||
|
||||
func handlePacket(pkt packet.Packet) {
|
||||
|
||||
// log.Tracef("handling packet: %s", pkt)
|
||||
log.Tracef("handling packet: %s", pkt)
|
||||
|
||||
// allow local dns
|
||||
if pkt.MatchesIP(packet.Remote, localNet4) && pkt.GetTCPUDPHeader() != nil && pkt.GetTCPUDPHeader().DstPort == 53 {
|
||||
if pkt.Info().Src.Equal(pkt.Info().Dst) && pkt.Info().DstPort == 53 {
|
||||
log.Tracef("accepting local dns: %s", pkt)
|
||||
pkt.PermanentAccept()
|
||||
return
|
||||
}
|
||||
|
||||
// allow ICMP and IGMP
|
||||
// allow ICMP, IGMP and DHCP
|
||||
// TODO: actually handle these
|
||||
switch pkt.GetIPHeader().Protocol {
|
||||
switch pkt.Info().Protocol {
|
||||
case packet.ICMP:
|
||||
log.Tracef("accepting ICMP: %s", pkt)
|
||||
pkt.PermanentAccept()
|
||||
return
|
||||
case packet.ICMPv6:
|
||||
log.Tracef("accepting ICMPv6: %s", pkt)
|
||||
pkt.PermanentAccept()
|
||||
return
|
||||
case packet.IGMP:
|
||||
log.Tracef("accepting IGMP: %s", pkt)
|
||||
pkt.PermanentAccept()
|
||||
return
|
||||
case packet.UDP:
|
||||
if pkt.Info().DstPort == 67 || pkt.Info().DstPort == 68 {
|
||||
log.Tracef("accepting DHCP: %s", pkt)
|
||||
pkt.PermanentAccept()
|
||||
return
|
||||
}
|
||||
}
|
||||
|
||||
// log.Debugf("firewall: pkt %s has ID %s", pkt, pkt.GetLinkID())
|
||||
@@ -122,11 +132,11 @@ func handlePacket(pkt packet.Packet) {
|
||||
// check if packet is destined for tunnel
|
||||
// switch pkt.IPVersion() {
|
||||
// case packet.IPv4:
|
||||
// if TunnelNet4 != nil && TunnelNet4.Contains(pkt.GetIPHeader().Dst) {
|
||||
// if TunnelNet4 != nil && TunnelNet4.Contains(pkt.Info().Dst) {
|
||||
// tunnelHandler(pkt)
|
||||
// }
|
||||
// case packet.IPv6:
|
||||
// if TunnelNet6 != nil && TunnelNet6.Contains(pkt.GetIPHeader().Dst) {
|
||||
// if TunnelNet6 != nil && TunnelNet6.Contains(pkt.Info().Dst) {
|
||||
// tunnelHandler(pkt)
|
||||
// }
|
||||
// }
|
||||
@@ -169,8 +179,11 @@ func initialHandler(pkt packet.Packet, link *network.Link) {
|
||||
// add new Link to Communication (and save both)
|
||||
comm.AddLink(link)
|
||||
|
||||
log.Tracef("comm [%s] has new link [%s]", comm, link)
|
||||
|
||||
// reroute dns requests to nameserver
|
||||
if comm.Process().Pid != os.Getpid() && pkt.IsOutbound() && pkt.GetTCPUDPHeader() != nil && !pkt.GetIPHeader().Dst.Equal(localhost) && pkt.GetTCPUDPHeader().DstPort == 53 {
|
||||
if comm.Process().Pid != os.Getpid() && pkt.IsOutbound() && pkt.Info().DstPort == 53 && !pkt.Info().Src.Equal(pkt.Info().Dst) {
|
||||
log.Tracef("redirecting [%s] to nameserver", link)
|
||||
link.RerouteToNameserver()
|
||||
verdict(pkt, link.GetVerdict())
|
||||
link.StopFirewallHandler()
|
||||
@@ -283,7 +296,7 @@ func verdict(pkt packet.Packet, action network.Verdict) {
|
||||
}
|
||||
|
||||
// func tunnelHandler(pkt packet.Packet) {
|
||||
// tunnelInfo := GetTunnelInfo(pkt.GetIPHeader().Dst)
|
||||
// tunnelInfo := GetTunnelInfo(pkt.Info().Dst)
|
||||
// if tunnelInfo == nil {
|
||||
// pkt.Block()
|
||||
// return
|
||||
|
||||
@@ -3,8 +3,12 @@ package interception
|
||||
import (
|
||||
"fmt"
|
||||
|
||||
"github.com/Safing/portmaster/firewall/interception/windivert"
|
||||
"github.com/Safing/portbase/log"
|
||||
"github.com/Safing/portbase/notifications"
|
||||
"github.com/Safing/portbase/utils/osdetail"
|
||||
"github.com/Safing/portmaster/firewall/interception/windowskext"
|
||||
"github.com/Safing/portmaster/network/packet"
|
||||
"github.com/Safing/portmaster/updates"
|
||||
)
|
||||
|
||||
var Packets chan packet.Packet
|
||||
@@ -17,15 +21,73 @@ func init() {
|
||||
// Start starts the interception.
|
||||
func Start() error {
|
||||
|
||||
wd, err := windivert.New("/WinDivert.dll", "")
|
||||
dllFile, err := updates.GetPlatformFile("kext/portmaster-kext.dll")
|
||||
if err != nil {
|
||||
return fmt.Errorf("firewall/interception: could not init windivert: %s", err)
|
||||
return fmt.Errorf("interception: could not get kext dll: %s", err)
|
||||
}
|
||||
kextFile, err := updates.GetPlatformFile("kext/portmaster-kext.sys")
|
||||
if err != nil {
|
||||
return fmt.Errorf("interception: could not get kext sys: %s", err)
|
||||
}
|
||||
|
||||
return wd.Packets(Packets)
|
||||
err = windowskext.Init(dllFile.Path(), kextFile.Path())
|
||||
if err != nil {
|
||||
return fmt.Errorf("interception: could not init windows kext: %s", err)
|
||||
}
|
||||
|
||||
err = windowskext.Start()
|
||||
if err != nil {
|
||||
return fmt.Errorf("interception: could not start windows kext: %s", err)
|
||||
}
|
||||
|
||||
go windowskext.Handler(Packets)
|
||||
go handleWindowsDNSCache()
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Stop starts the interception.
|
||||
func Stop() error {
|
||||
return nil
|
||||
return windowskext.Stop()
|
||||
}
|
||||
|
||||
func handleWindowsDNSCache() {
|
||||
|
||||
err := osdetail.StopService("dnscache")
|
||||
if err != nil {
|
||||
// cannot stop dnscache, try disabling
|
||||
if err == osdetail.ErrServiceNotStoppable {
|
||||
err := osdetail.DisableDNSCache()
|
||||
if err != nil {
|
||||
log.Warningf("firewall/interception: failed to disable Windows Service \"DNS Client\" (dnscache) for better interception: %s", err)
|
||||
notifyDisableDNSCache()
|
||||
}
|
||||
notifyRebootRequired()
|
||||
return
|
||||
}
|
||||
|
||||
// error while stopping service
|
||||
log.Warningf("firewall/interception: failed to stop Windows Service \"DNS Client\" (dnscache) for better interception: %s", err)
|
||||
notifyDisableDNSCache()
|
||||
}
|
||||
|
||||
// log that service is stopped
|
||||
log.Info("firewall/interception: Windows Service \"DNS Client\" (dnscache) is stopped for better interception")
|
||||
|
||||
}
|
||||
|
||||
func notifyDisableDNSCache() {
|
||||
(¬ifications.Notification{
|
||||
ID: "windows-disable-dns-cache",
|
||||
Message: "The Portmaster needs the Windows Service \"DNS Client\" (dnscache) to be disabled for best effectiveness.",
|
||||
Type: notifications.Warning,
|
||||
}).Init().Save()
|
||||
}
|
||||
|
||||
func notifyRebootRequired() {
|
||||
(¬ifications.Notification{
|
||||
ID: "windows-dnscache-reboot-required",
|
||||
Message: "Please restart your system to complete Portmaster integration.",
|
||||
Type: notifications.Warning,
|
||||
}).Init().Save()
|
||||
}
|
||||
|
||||
@@ -1,21 +0,0 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
|
||||
"github.com/Safing/portmaster/firewall/interception/windowskext"
|
||||
)
|
||||
|
||||
func main() {
|
||||
kext, err := windowskext.New("./WinDivert.dll")
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
|
||||
vR, err := kext.RecvVerdictRequest()
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
|
||||
fmt.Printf("verdictRequest: %+v", vR)
|
||||
}
|
||||
@@ -1,201 +0,0 @@
|
||||
Apache License
|
||||
Version 2.0, January 2004
|
||||
http://www.apache.org/licenses/
|
||||
|
||||
TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
|
||||
|
||||
1. Definitions.
|
||||
|
||||
"License" shall mean the terms and conditions for use, reproduction,
|
||||
and distribution as defined by Sections 1 through 9 of this document.
|
||||
|
||||
"Licensor" shall mean the copyright owner or entity authorized by
|
||||
the copyright owner that is granting the License.
|
||||
|
||||
"Legal Entity" shall mean the union of the acting entity and all
|
||||
other entities that control, are controlled by, or are under common
|
||||
control with that entity. For the purposes of this definition,
|
||||
"control" means (i) the power, direct or indirect, to cause the
|
||||
direction or management of such entity, whether by contract or
|
||||
otherwise, or (ii) ownership of fifty percent (50%) or more of the
|
||||
outstanding shares, or (iii) beneficial ownership of such entity.
|
||||
|
||||
"You" (or "Your") shall mean an individual or Legal Entity
|
||||
exercising permissions granted by this License.
|
||||
|
||||
"Source" form shall mean the preferred form for making modifications,
|
||||
including but not limited to software source code, documentation
|
||||
source, and configuration files.
|
||||
|
||||
"Object" form shall mean any form resulting from mechanical
|
||||
transformation or translation of a Source form, including but
|
||||
not limited to compiled object code, generated documentation,
|
||||
and conversions to other media types.
|
||||
|
||||
"Work" shall mean the work of authorship, whether in Source or
|
||||
Object form, made available under the License, as indicated by a
|
||||
copyright notice that is included in or attached to the work
|
||||
(an example is provided in the Appendix below).
|
||||
|
||||
"Derivative Works" shall mean any work, whether in Source or Object
|
||||
form, that is based on (or derived from) the Work and for which the
|
||||
editorial revisions, annotations, elaborations, or other modifications
|
||||
represent, as a whole, an original work of authorship. For the purposes
|
||||
of this License, Derivative Works shall not include works that remain
|
||||
separable from, or merely link (or bind by name) to the interfaces of,
|
||||
the Work and Derivative Works thereof.
|
||||
|
||||
"Contribution" shall mean any work of authorship, including
|
||||
the original version of the Work and any modifications or additions
|
||||
to that Work or Derivative Works thereof, that is intentionally
|
||||
submitted to Licensor for inclusion in the Work by the copyright owner
|
||||
or by an individual or Legal Entity authorized to submit on behalf of
|
||||
the copyright owner. For the purposes of this definition, "submitted"
|
||||
means any form of electronic, verbal, or written communication sent
|
||||
to the Licensor or its representatives, including but not limited to
|
||||
communication on electronic mailing lists, source code control systems,
|
||||
and issue tracking systems that are managed by, or on behalf of, the
|
||||
Licensor for the purpose of discussing and improving the Work, but
|
||||
excluding communication that is conspicuously marked or otherwise
|
||||
designated in writing by the copyright owner as "Not a Contribution."
|
||||
|
||||
"Contributor" shall mean Licensor and any individual or Legal Entity
|
||||
on behalf of whom a Contribution has been received by Licensor and
|
||||
subsequently incorporated within the Work.
|
||||
|
||||
2. Grant of Copyright License. Subject to the terms and conditions of
|
||||
this License, each Contributor hereby grants to You a perpetual,
|
||||
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
|
||||
copyright license to reproduce, prepare Derivative Works of,
|
||||
publicly display, publicly perform, sublicense, and distribute the
|
||||
Work and such Derivative Works in Source or Object form.
|
||||
|
||||
3. Grant of Patent License. Subject to the terms and conditions of
|
||||
this License, each Contributor hereby grants to You a perpetual,
|
||||
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
|
||||
(except as stated in this section) patent license to make, have made,
|
||||
use, offer to sell, sell, import, and otherwise transfer the Work,
|
||||
where such license applies only to those patent claims licensable
|
||||
by such Contributor that are necessarily infringed by their
|
||||
Contribution(s) alone or by combination of their Contribution(s)
|
||||
with the Work to which such Contribution(s) was submitted. If You
|
||||
institute patent litigation against any entity (including a
|
||||
cross-claim or counterclaim in a lawsuit) alleging that the Work
|
||||
or a Contribution incorporated within the Work constitutes direct
|
||||
or contributory patent infringement, then any patent licenses
|
||||
granted to You under this License for that Work shall terminate
|
||||
as of the date such litigation is filed.
|
||||
|
||||
4. Redistribution. You may reproduce and distribute copies of the
|
||||
Work or Derivative Works thereof in any medium, with or without
|
||||
modifications, and in Source or Object form, provided that You
|
||||
meet the following conditions:
|
||||
|
||||
(a) You must give any other recipients of the Work or
|
||||
Derivative Works a copy of this License; and
|
||||
|
||||
(b) You must cause any modified files to carry prominent notices
|
||||
stating that You changed the files; and
|
||||
|
||||
(c) You must retain, in the Source form of any Derivative Works
|
||||
that You distribute, all copyright, patent, trademark, and
|
||||
attribution notices from the Source form of the Work,
|
||||
excluding those notices that do not pertain to any part of
|
||||
the Derivative Works; and
|
||||
|
||||
(d) If the Work includes a "NOTICE" text file as part of its
|
||||
distribution, then any Derivative Works that You distribute must
|
||||
include a readable copy of the attribution notices contained
|
||||
within such NOTICE file, excluding those notices that do not
|
||||
pertain to any part of the Derivative Works, in at least one
|
||||
of the following places: within a NOTICE text file distributed
|
||||
as part of the Derivative Works; within the Source form or
|
||||
documentation, if provided along with the Derivative Works; or,
|
||||
within a display generated by the Derivative Works, if and
|
||||
wherever such third-party notices normally appear. The contents
|
||||
of the NOTICE file are for informational purposes only and
|
||||
do not modify the License. You may add Your own attribution
|
||||
notices within Derivative Works that You distribute, alongside
|
||||
or as an addendum to the NOTICE text from the Work, provided
|
||||
that such additional attribution notices cannot be construed
|
||||
as modifying the License.
|
||||
|
||||
You may add Your own copyright statement to Your modifications and
|
||||
may provide additional or different license terms and conditions
|
||||
for use, reproduction, or distribution of Your modifications, or
|
||||
for any such Derivative Works as a whole, provided Your use,
|
||||
reproduction, and distribution of the Work otherwise complies with
|
||||
the conditions stated in this License.
|
||||
|
||||
5. Submission of Contributions. Unless You explicitly state otherwise,
|
||||
any Contribution intentionally submitted for inclusion in the Work
|
||||
by You to the Licensor shall be under the terms and conditions of
|
||||
this License, without any additional terms or conditions.
|
||||
Notwithstanding the above, nothing herein shall supersede or modify
|
||||
the terms of any separate license agreement you may have executed
|
||||
with Licensor regarding such Contributions.
|
||||
|
||||
6. Trademarks. This License does not grant permission to use the trade
|
||||
names, trademarks, service marks, or product names of the Licensor,
|
||||
except as required for reasonable and customary use in describing the
|
||||
origin of the Work and reproducing the content of the NOTICE file.
|
||||
|
||||
7. Disclaimer of Warranty. Unless required by applicable law or
|
||||
agreed to in writing, Licensor provides the Work (and each
|
||||
Contributor provides its Contributions) on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
|
||||
implied, including, without limitation, any warranties or conditions
|
||||
of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
|
||||
PARTICULAR PURPOSE. You are solely responsible for determining the
|
||||
appropriateness of using or redistributing the Work and assume any
|
||||
risks associated with Your exercise of permissions under this License.
|
||||
|
||||
8. Limitation of Liability. In no event and under no legal theory,
|
||||
whether in tort (including negligence), contract, or otherwise,
|
||||
unless required by applicable law (such as deliberate and grossly
|
||||
negligent acts) or agreed to in writing, shall any Contributor be
|
||||
liable to You for damages, including any direct, indirect, special,
|
||||
incidental, or consequential damages of any character arising as a
|
||||
result of this License or out of the use or inability to use the
|
||||
Work (including but not limited to damages for loss of goodwill,
|
||||
work stoppage, computer failure or malfunction, or any and all
|
||||
other commercial damages or losses), even if such Contributor
|
||||
has been advised of the possibility of such damages.
|
||||
|
||||
9. Accepting Warranty or Additional Liability. While redistributing
|
||||
the Work or Derivative Works thereof, You may choose to offer,
|
||||
and charge a fee for, acceptance of support, warranty, indemnity,
|
||||
or other liability obligations and/or rights consistent with this
|
||||
License. However, in accepting such obligations, You may act only
|
||||
on Your own behalf and on Your sole responsibility, not on behalf
|
||||
of any other Contributor, and only if You agree to indemnify,
|
||||
defend, and hold each Contributor harmless for any liability
|
||||
incurred by, or claims asserted against, such Contributor by reason
|
||||
of your accepting any such warranty or additional liability.
|
||||
|
||||
END OF TERMS AND CONDITIONS
|
||||
|
||||
APPENDIX: How to apply the Apache License to your work.
|
||||
|
||||
To apply the Apache License to your work, attach the following
|
||||
boilerplate notice, with the fields enclosed by brackets "{}"
|
||||
replaced with your own identifying information. (Don't include
|
||||
the brackets!) The text should be enclosed in the appropriate
|
||||
comment syntax for the file format. We also recommend that a
|
||||
file or class name and description of purpose be included on the
|
||||
same "printed page" as the copyright notice for easier
|
||||
identification within third-party archives.
|
||||
|
||||
Copyright {yyyy} {name of copyright owner}
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
@@ -1,42 +1,3 @@
|
||||
Go-NFQueue
|
||||
==========
|
||||
Go Wrapper For Creating IPTables' NFQueue clients in Go
|
||||
|
||||
Usage
|
||||
------
|
||||
Check the `examples/main.go` file
|
||||
|
||||
```bash
|
||||
cd $GOPATH/github.com/OneOfOne/go-nfqueue/examples
|
||||
go build -race && sudo ./examples
|
||||
```
|
||||
* Open another terminal :
|
||||
```bash
|
||||
sudo iptables -I INPUT 1 -m conntrack --ctstate NEW -j NFQUEUE --queue-num 0
|
||||
#or
|
||||
sudo iptables -I INPUT -i eth0 -m conntrack --ctstate NEW -j NFQUEUE --queue-num 0
|
||||
curl --head localhost
|
||||
ping localhost
|
||||
sudo iptables -D INPUT -m conntrack --ctstate NEW -j NFQUEUE --queue-num 0
|
||||
```
|
||||
Then you can `ctrl+c` the program to exit.
|
||||
|
||||
* If you have recent enough iptables/nfqueue you could also use a balanced (multithreaded queue).
|
||||
* check the example in `examples/mq/multiqueue.go`
|
||||
|
||||
```bash
|
||||
iptables -I INPUT 1 -m conntrack --ctstate NEW -j NFQUEUE --queue-balance 0:5 --queue-cpu-fanout
|
||||
```
|
||||
Notes
|
||||
-----
|
||||
|
||||
You must run the executable as root.
|
||||
This is *WIP*, but all patches are welcome.
|
||||
|
||||
License
|
||||
-------
|
||||
go-nfqueue is under the Apache v2 license, check the included license file.
|
||||
Copyright © [Ahmed W.](http://www.limitlessfx.com/)
|
||||
See the included `LICENSE` file.
|
||||
|
||||
> Copyright (c) 2014 Ahmed W.
|
||||
Parts of this package (this directory) are forked from the go-nfqueue repo: https://github.com/OneOfOne/go-nfqueue
|
||||
These portions are copyrighted by Ahmed W.
|
||||
The (high probable) fork commit is: https://github.com/OneOfOne/go-nfqueue/commit/3bdd8bdfd98a1ed51119f9cf7494162484dfbe7c
|
||||
|
||||
@@ -1,154 +1,130 @@
|
||||
package windowskext
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"encoding/binary"
|
||||
"fmt"
|
||||
"net"
|
||||
|
||||
"github.com/google/gopacket"
|
||||
"github.com/google/gopacket/layers"
|
||||
"github.com/tevino/abool"
|
||||
|
||||
"github.com/Safing/portbase/log"
|
||||
"github.com/Safing/portmaster/network/packet"
|
||||
|
||||
"github.com/tevino/abool"
|
||||
)
|
||||
|
||||
func (wd *WinDivert) Packets(packets chan packet.Packet) error {
|
||||
go wd.packetHandler(packets)
|
||||
return nil
|
||||
// VerdictRequest is the request structure from the Kext.
|
||||
type VerdictRequest struct {
|
||||
id uint32 /* ID from RegisterPacket */
|
||||
processID uint64 /* Process ID. Nice to have*/
|
||||
direction uint8
|
||||
ipV6 uint8 /* True: IPv6, False: IPv4 */
|
||||
protocol uint8 /* Protocol */
|
||||
_ uint8
|
||||
localIP [4]uint32 /* Source Address */
|
||||
remoteIP [4]uint32 /* Destination Address */
|
||||
localPort uint16 /* Source Port */
|
||||
remotePort uint16 /* Destination port */
|
||||
compartmentId uint32
|
||||
interfaceIndex uint32
|
||||
subInterfaceIndex uint32
|
||||
packetSize uint32
|
||||
}
|
||||
|
||||
func (wd *WinDivert) packetHandler(packets chan packet.Packet) {
|
||||
defer close(packets)
|
||||
|
||||
for {
|
||||
if !wd.valid.IsSet() {
|
||||
// Handler transforms received packets to the Packet interface.
|
||||
func Handler(packets chan packet.Packet) {
|
||||
if !ready.IsSet() {
|
||||
return
|
||||
}
|
||||
|
||||
packetData, packetAddress, err := wd.Recv()
|
||||
defer close(packets)
|
||||
|
||||
for {
|
||||
if !ready.IsSet() {
|
||||
return
|
||||
}
|
||||
|
||||
packetInfo, err := RecvVerdictRequest()
|
||||
if err != nil {
|
||||
log.Warningf("failed to get packet from windivert: %s", err)
|
||||
log.Warningf("failed to get packet from windows kext: %s", err)
|
||||
continue
|
||||
}
|
||||
|
||||
ipHeader, tpcUdpHeader, payload, err := parseIpPacket(packetData)
|
||||
if err != nil {
|
||||
log.Warningf("failed to parse packet from windivert: %s", err)
|
||||
log.Warningf("failed packet payload (%d): %s", len(packetData), string(packetData))
|
||||
if packetInfo == nil {
|
||||
continue
|
||||
}
|
||||
|
||||
// log.Tracef("packet: %+v", packetInfo)
|
||||
|
||||
// New Packet
|
||||
new := &Packet{
|
||||
windivert: wd,
|
||||
packetData: packetData,
|
||||
packetAddress: packetAddress,
|
||||
verdictRequest: packetInfo,
|
||||
verdictSet: abool.NewBool(false),
|
||||
}
|
||||
new.IPHeader = ipHeader
|
||||
new.TCPUDPHeader = tpcUdpHeader
|
||||
new.Payload = payload
|
||||
if packetAddress.Direction == directionInbound {
|
||||
new.Direction = packet.InBound
|
||||
|
||||
info := new.Info()
|
||||
info.Direction = packetInfo.direction > 0
|
||||
info.InTunnel = false
|
||||
info.Protocol = packet.IPProtocol(packetInfo.protocol)
|
||||
|
||||
// IP version
|
||||
if packetInfo.ipV6 == 1 {
|
||||
info.Version = packet.IPv6
|
||||
} else {
|
||||
new.Direction = packet.OutBound
|
||||
info.Version = packet.IPv4
|
||||
}
|
||||
|
||||
// IPs
|
||||
if info.Version == packet.IPv4 {
|
||||
// IPv4
|
||||
if info.Direction {
|
||||
// Inbound
|
||||
info.Src = convertIPv4(packetInfo.remoteIP)
|
||||
info.Dst = convertIPv4(packetInfo.localIP)
|
||||
} else {
|
||||
// Outbound
|
||||
info.Src = convertIPv4(packetInfo.localIP)
|
||||
info.Dst = convertIPv4(packetInfo.remoteIP)
|
||||
}
|
||||
} else {
|
||||
// IPv6
|
||||
if info.Direction {
|
||||
// Inbound
|
||||
info.Src = convertIPv6(packetInfo.remoteIP)
|
||||
info.Dst = convertIPv6(packetInfo.localIP)
|
||||
} else {
|
||||
// Outbound
|
||||
info.Src = convertIPv6(packetInfo.localIP)
|
||||
info.Dst = convertIPv6(packetInfo.remoteIP)
|
||||
}
|
||||
}
|
||||
|
||||
// Ports
|
||||
if info.Direction {
|
||||
// Inbound
|
||||
info.SrcPort = packetInfo.remotePort
|
||||
info.DstPort = packetInfo.localPort
|
||||
} else {
|
||||
// Outbound
|
||||
info.SrcPort = packetInfo.localPort
|
||||
info.DstPort = packetInfo.remotePort
|
||||
}
|
||||
|
||||
packets <- new
|
||||
}
|
||||
}
|
||||
|
||||
func parseIpPacket(packetData []byte) (ipHeader *packet.IPHeader, tpcUdpHeader *packet.TCPUDPHeader, payload []byte, err error) {
|
||||
|
||||
var parsedPacket gopacket.Packet
|
||||
|
||||
if len(packetData) == 0 {
|
||||
return nil, nil, nil, errors.New("empty packet")
|
||||
func convertIPv4(input [4]uint32) net.IP {
|
||||
return net.IPv4(
|
||||
uint8(input[0]>>24&0xFF),
|
||||
uint8(input[0]>>16&0xFF),
|
||||
uint8(input[0]>>8&0xFF),
|
||||
uint8(input[0]&0xFF),
|
||||
)
|
||||
}
|
||||
|
||||
switch packetData[0] >> 4 {
|
||||
case 4:
|
||||
parsedPacket = gopacket.NewPacket(packetData, layers.LayerTypeIPv4, gopacket.DecodeOptions{Lazy: true, NoCopy: true})
|
||||
if ipv4Layer := parsedPacket.Layer(layers.LayerTypeIPv4); ipv4Layer != nil {
|
||||
ipv4, _ := ipv4Layer.(*layers.IPv4)
|
||||
ipHeader = &packet.IPHeader{
|
||||
Version: 4,
|
||||
Protocol: packet.IPProtocol(ipv4.Protocol),
|
||||
Tos: ipv4.TOS,
|
||||
TTL: ipv4.TTL,
|
||||
Src: ipv4.SrcIP,
|
||||
Dst: ipv4.DstIP,
|
||||
func convertIPv6(input [4]uint32) net.IP {
|
||||
addressBuf := make([]byte, 16)
|
||||
for i := 0; i < 4; i++ {
|
||||
binary.BigEndian.PutUint32(addressBuf[i:i+3], input[i])
|
||||
}
|
||||
} else {
|
||||
var err error
|
||||
if errLayer := parsedPacket.ErrorLayer(); errLayer != nil {
|
||||
err = errLayer.Error()
|
||||
}
|
||||
return nil, nil, nil, fmt.Errorf("failed to parse IPv4 packet: %s", err)
|
||||
}
|
||||
case 6:
|
||||
parsedPacket = gopacket.NewPacket(packetData, layers.LayerTypeIPv6, gopacket.DecodeOptions{Lazy: true, NoCopy: true})
|
||||
if ipv6Layer := parsedPacket.Layer(layers.LayerTypeIPv6); ipv6Layer != nil {
|
||||
ipv6, _ := ipv6Layer.(*layers.IPv6)
|
||||
ipHeader = &packet.IPHeader{
|
||||
Version: 6,
|
||||
Protocol: packet.IPProtocol(ipv6.NextHeader),
|
||||
Tos: ipv6.TrafficClass,
|
||||
TTL: ipv6.HopLimit,
|
||||
Src: ipv6.SrcIP,
|
||||
Dst: ipv6.DstIP,
|
||||
}
|
||||
} else {
|
||||
var err error
|
||||
if errLayer := parsedPacket.ErrorLayer(); errLayer != nil {
|
||||
err = errLayer.Error()
|
||||
}
|
||||
return nil, nil, nil, fmt.Errorf("failed to parse IPv6 packet: %s", err)
|
||||
}
|
||||
default:
|
||||
return nil, nil, nil, errors.New("unknown IP version")
|
||||
}
|
||||
|
||||
switch ipHeader.Protocol {
|
||||
case packet.TCP:
|
||||
if tcpLayer := parsedPacket.Layer(layers.LayerTypeTCP); tcpLayer != nil {
|
||||
tcp, _ := tcpLayer.(*layers.TCP)
|
||||
tpcUdpHeader = &packet.TCPUDPHeader{
|
||||
SrcPort: uint16(tcp.SrcPort),
|
||||
DstPort: uint16(tcp.DstPort),
|
||||
Checksum: tcp.Checksum,
|
||||
}
|
||||
} else {
|
||||
var err error
|
||||
if errLayer := parsedPacket.ErrorLayer(); errLayer != nil {
|
||||
err = errLayer.Error()
|
||||
}
|
||||
return nil, nil, nil, fmt.Errorf("could not parse TCP layer: %s", err)
|
||||
}
|
||||
case packet.UDP:
|
||||
if udpLayer := parsedPacket.Layer(layers.LayerTypeUDP); udpLayer != nil {
|
||||
udp, _ := udpLayer.(*layers.UDP)
|
||||
tpcUdpHeader = &packet.TCPUDPHeader{
|
||||
SrcPort: uint16(udp.SrcPort),
|
||||
DstPort: uint16(udp.DstPort),
|
||||
Checksum: udp.Checksum,
|
||||
}
|
||||
} else {
|
||||
var err error
|
||||
if errLayer := parsedPacket.ErrorLayer(); errLayer != nil {
|
||||
err = errLayer.Error()
|
||||
}
|
||||
return nil, nil, nil, fmt.Errorf("could not parse UDP layer: %s", err)
|
||||
}
|
||||
}
|
||||
|
||||
if appLayer := parsedPacket.ApplicationLayer(); appLayer != nil {
|
||||
payload = appLayer.Payload()
|
||||
}
|
||||
|
||||
if errLayer := parsedPacket.ErrorLayer(); errLayer != nil {
|
||||
return nil, nil, nil, errLayer.Error()
|
||||
}
|
||||
|
||||
return
|
||||
return net.IP(addressBuf)
|
||||
}
|
||||
|
||||
@@ -1,61 +1,206 @@
|
||||
package windowskext
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"sync"
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"github.com/Safing/portmaster/network"
|
||||
"github.com/tevino/abool"
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
// Package errors
|
||||
var (
|
||||
ErrKextNotReady = errors.New("the windows kernel extension (driver) is not ready to accept commands")
|
||||
|
||||
kext *WinKext
|
||||
kextLock sync.RWMutex
|
||||
ready = abool.NewBool(false)
|
||||
)
|
||||
|
||||
// WinKext holds the DLL handle.
|
||||
type WinKext struct {
|
||||
sync.RWMutex
|
||||
|
||||
dll *windows.DLL
|
||||
driverPath string
|
||||
|
||||
init *windows.Proc
|
||||
start *windows.Proc
|
||||
stop *windows.Proc
|
||||
recvVerdictRequest *windows.Proc
|
||||
|
||||
valid *abool.AtomicBool
|
||||
setVerdict *windows.Proc
|
||||
getPayload *windows.Proc
|
||||
}
|
||||
|
||||
type VerdictRequest struct {
|
||||
ID uint32
|
||||
ProcessID uint32
|
||||
Direction bool
|
||||
IPv6 bool
|
||||
Protocol uint8
|
||||
SrcIP [4]uint32
|
||||
DstIP [4]uint32
|
||||
SrcPort uint16
|
||||
DstPort uint16
|
||||
// Init initializes the DLL and the Kext (Kernel Driver).
|
||||
func Init(dllPath, driverPath string) error {
|
||||
|
||||
new := &WinKext{
|
||||
driverPath: driverPath,
|
||||
}
|
||||
|
||||
func New(dllLocation string) (*WinKext, error) {
|
||||
|
||||
new := &WinKext{}
|
||||
var err error
|
||||
|
||||
// load dll
|
||||
new.dll, err = windows.LoadDLL(dllLocation)
|
||||
new.dll, err = windows.LoadDLL(dllPath)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
return err
|
||||
}
|
||||
|
||||
// load functions
|
||||
new.init, err = new.dll.FindProc("PortmasterInit")
|
||||
if err != nil {
|
||||
return fmt.Errorf("could not find proc PortmasterStart in dll: %s", err)
|
||||
}
|
||||
new.start, err = new.dll.FindProc("PortmasterStart")
|
||||
if err != nil {
|
||||
return fmt.Errorf("could not find proc PortmasterStart in dll: %s", err)
|
||||
}
|
||||
new.stop, err = new.dll.FindProc("PortmasterStop")
|
||||
if err != nil {
|
||||
return fmt.Errorf("could not find proc PortmasterStop in dll: %s", err)
|
||||
}
|
||||
new.recvVerdictRequest, err = new.dll.FindProc("PortmasterRecvVerdictRequest")
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("could not find proc PortmasterRecvVerdictRequest: %s", err)
|
||||
return fmt.Errorf("could not find proc PortmasterRecvVerdictRequest in dll: %s", err)
|
||||
}
|
||||
new.setVerdict, err = new.dll.FindProc("PortmasterSetVerdict")
|
||||
if err != nil {
|
||||
return fmt.Errorf("could not find proc PortmasterSetVerdict in dll: %s", err)
|
||||
}
|
||||
new.getPayload, err = new.dll.FindProc("PortmasterGetPayload")
|
||||
if err != nil {
|
||||
return fmt.Errorf("could not find proc PortmasterGetPayload in dll: %s", err)
|
||||
}
|
||||
|
||||
return new, nil
|
||||
// initialize dll/kext
|
||||
rc, _, lastErr := new.init.Call()
|
||||
if rc != windows.NO_ERROR {
|
||||
return formatErr(lastErr)
|
||||
}
|
||||
|
||||
// set kext
|
||||
kextLock.Lock()
|
||||
defer kextLock.Unlock()
|
||||
kext = new
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Start intercepting.
|
||||
func Start() error {
|
||||
kextLock.Lock()
|
||||
defer kextLock.Unlock()
|
||||
|
||||
// convert to C string
|
||||
charArray := make([]byte, len(kext.driverPath)+1)
|
||||
copy(charArray, []byte(kext.driverPath))
|
||||
charArray[len(charArray)-1] = 0 // force NULL byte at the end
|
||||
|
||||
rc, _, lastErr := kext.start.Call(
|
||||
uintptr(unsafe.Pointer(&charArray[0])),
|
||||
)
|
||||
if rc != windows.NO_ERROR {
|
||||
return formatErr(lastErr)
|
||||
}
|
||||
|
||||
ready.Set()
|
||||
return nil
|
||||
}
|
||||
|
||||
// Stop intercepting.
|
||||
func Stop() error {
|
||||
kextLock.Lock()
|
||||
defer kextLock.Unlock()
|
||||
if !ready.IsSet() {
|
||||
return ErrKextNotReady
|
||||
}
|
||||
ready.UnSet()
|
||||
|
||||
rc, _, lastErr := kext.stop.Call()
|
||||
if rc != windows.NO_ERROR {
|
||||
return formatErr(lastErr)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// RecvVerdictRequest waits for the next verdict request from the kext. If a timeout is reached, both *VerdictRequest and error will be nil.
|
||||
func RecvVerdictRequest() (*VerdictRequest, error) {
|
||||
kextLock.RLock()
|
||||
defer kextLock.RUnlock()
|
||||
if !ready.IsSet() {
|
||||
return nil, ErrKextNotReady
|
||||
}
|
||||
|
||||
func (kext *WinKext) RecvVerdictRequest() (*VerdictRequest, error) {
|
||||
new := &VerdictRequest{}
|
||||
|
||||
rc, _, lastErr := kext.recvVerdictRequest.Call(
|
||||
uintptr(unsafe.Pointer(new)),
|
||||
)
|
||||
if rc != 0 {
|
||||
return nil, lastErr
|
||||
if rc == 13 /* ERROR_INVALID_DATA */ {
|
||||
return nil, nil
|
||||
}
|
||||
return nil, formatErr(lastErr)
|
||||
}
|
||||
return new, nil
|
||||
}
|
||||
|
||||
// SetVerdict sets the verdict for a packet and/or connection.
|
||||
func SetVerdict(packetID uint32, verdict network.Verdict) error {
|
||||
kextLock.RLock()
|
||||
defer kextLock.RUnlock()
|
||||
if !ready.IsSet() {
|
||||
return ErrKextNotReady
|
||||
}
|
||||
|
||||
rc, _, lastErr := kext.setVerdict.Call(
|
||||
uintptr(packetID),
|
||||
uintptr(verdict),
|
||||
)
|
||||
if rc != windows.NO_ERROR {
|
||||
return formatErr(lastErr)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// GetPayload returns the payload of a packet.
|
||||
func GetPayload(packetID uint32, packetSize uint32) ([]byte, error) {
|
||||
kextLock.RLock()
|
||||
defer kextLock.RUnlock()
|
||||
if !ready.IsSet() {
|
||||
return nil, ErrKextNotReady
|
||||
}
|
||||
|
||||
buf := make([]byte, packetSize)
|
||||
|
||||
rc, _, lastErr := kext.getPayload.Call(
|
||||
uintptr(packetID),
|
||||
uintptr(unsafe.Pointer(&buf[0])),
|
||||
uintptr(unsafe.Pointer(&packetSize)),
|
||||
)
|
||||
if rc != windows.NO_ERROR {
|
||||
return nil, formatErr(lastErr)
|
||||
}
|
||||
|
||||
if packetSize == 0 {
|
||||
return nil, errors.New("windows kext did not return any data")
|
||||
}
|
||||
|
||||
if packetSize < uint32(len(buf)) {
|
||||
return buf[:packetSize], nil
|
||||
}
|
||||
return buf, nil
|
||||
}
|
||||
|
||||
func formatErr(err error) error {
|
||||
sysErr, ok := err.(syscall.Errno)
|
||||
if ok {
|
||||
return fmt.Errorf("%s [0x%X]", err, uintptr(sysErr))
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
@@ -1,55 +1,108 @@
|
||||
package windowskext
|
||||
|
||||
import (
|
||||
"sync"
|
||||
|
||||
"github.com/tevino/abool"
|
||||
|
||||
"github.com/Safing/portbase/log"
|
||||
"github.com/Safing/portmaster/network"
|
||||
"github.com/Safing/portmaster/network/packet"
|
||||
)
|
||||
|
||||
// Packet represents an IP packet.
|
||||
type Packet struct {
|
||||
packet.PacketBase
|
||||
|
||||
kextID uint32
|
||||
packetData []byte
|
||||
|
||||
verdictRequest *VerdictRequest
|
||||
verdictSet *abool.AtomicBool
|
||||
|
||||
payloadLoaded bool
|
||||
lock sync.Mutex
|
||||
}
|
||||
|
||||
// GetPayload returns the full raw packet.
|
||||
func (pkt *Packet) GetPayload() ([]byte, error) {
|
||||
pkt.lock.Lock()
|
||||
defer pkt.lock.Unlock()
|
||||
|
||||
if !pkt.payloadLoaded {
|
||||
pkt.payloadLoaded = true
|
||||
|
||||
payload, err := GetPayload(pkt.verdictRequest.id, pkt.verdictRequest.packetSize)
|
||||
if err != nil {
|
||||
log.Errorf("windowskext: failed to load payload %s", err)
|
||||
return nil, packet.ErrFailedToLoadPayload
|
||||
}
|
||||
pkt.Payload = payload
|
||||
}
|
||||
|
||||
if len(pkt.Payload) == 0 {
|
||||
return nil, packet.ErrFailedToLoadPayload
|
||||
}
|
||||
return pkt.Payload, nil
|
||||
}
|
||||
|
||||
// Accept accepts the packet.
|
||||
func (pkt *Packet) Accept() error {
|
||||
if pkt.verdictSet.SetToIf(false, true) {
|
||||
return pkt.windivert.Send(pkt.packetData, pkt.packetAddress)
|
||||
return SetVerdict(pkt.verdictRequest.id, -network.VerdictAccept)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// Block blocks the packet.
|
||||
func (pkt *Packet) Block() error {
|
||||
if pkt.verdictSet.SetToIf(false, true) {
|
||||
// TODO: implement blocking mechanism
|
||||
return nil
|
||||
return SetVerdict(pkt.verdictRequest.id, -network.VerdictBlock)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// Drop drops the packet.
|
||||
func (pkt *Packet) Drop() error {
|
||||
if pkt.verdictSet.SetToIf(false, true) {
|
||||
return SetVerdict(pkt.verdictRequest.id, -network.VerdictDrop)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// PermanentAccept permanently accepts connection (and the current packet).
|
||||
func (pkt *Packet) PermanentAccept() error {
|
||||
return pkt.Accept()
|
||||
if pkt.verdictSet.SetToIf(false, true) {
|
||||
return SetVerdict(pkt.verdictRequest.id, network.VerdictAccept)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// PermanentBlock permanently blocks connection (and the current packet).
|
||||
func (pkt *Packet) PermanentBlock() error {
|
||||
return pkt.Block()
|
||||
if pkt.verdictSet.SetToIf(false, true) {
|
||||
return SetVerdict(pkt.verdictRequest.id, network.VerdictBlock)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// PermanentDrop permanently drops connection (and the current packet).
|
||||
func (pkt *Packet) PermanentDrop() error {
|
||||
return pkt.Drop()
|
||||
if pkt.verdictSet.SetToIf(false, true) {
|
||||
return SetVerdict(pkt.verdictRequest.id, network.VerdictDrop)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// RerouteToNameserver permanently reroutes the connection to the local nameserver (and the current packet).
|
||||
func (pkt *Packet) RerouteToNameserver() error {
|
||||
if pkt.verdictSet.SetToIf(false, true) {
|
||||
return SetVerdict(pkt.verdictRequest.id, network.VerdictRerouteToNameserver)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// RerouteToTunnel permanently reroutes the connection to the local tunnel entrypoint (and the current packet).
|
||||
func (pkt *Packet) RerouteToTunnel() error {
|
||||
if pkt.verdictSet.SetToIf(false, true) {
|
||||
return SetVerdict(pkt.verdictRequest.id, network.VerdictRerouteToTunnel)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
26
firewall/interception/windowskext/test/endian/main.go
Normal file
26
firewall/interception/windowskext/test/endian/main.go
Normal file
@@ -0,0 +1,26 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"unsafe"
|
||||
)
|
||||
|
||||
const integerSize int = int(unsafe.Sizeof(0))
|
||||
|
||||
func isBigEndian() bool {
|
||||
var i int = 0x1
|
||||
bs := (*[integerSize]byte)(unsafe.Pointer(&i))
|
||||
if bs[0] == 0 {
|
||||
return true
|
||||
} else {
|
||||
return false
|
||||
}
|
||||
}
|
||||
|
||||
func main() {
|
||||
if isBigEndian() {
|
||||
fmt.Println("System is Big Endian (Network Byte Order): uint16 0x1234 is 0x1234 in memory")
|
||||
} else {
|
||||
fmt.Println("System is Little Endian (Host Byte Order): uint16 0x1234 is 0x3412 in memory")
|
||||
}
|
||||
}
|
||||
110
firewall/interception/windowskext/test/main.go
Normal file
110
firewall/interception/windowskext/test/main.go
Normal file
@@ -0,0 +1,110 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"os"
|
||||
"os/signal"
|
||||
"syscall"
|
||||
|
||||
"github.com/Safing/portbase/log"
|
||||
"github.com/Safing/portmaster/firewall/interception/windowskext"
|
||||
"github.com/Safing/portmaster/network/packet"
|
||||
)
|
||||
|
||||
var (
|
||||
packets chan packet.Packet
|
||||
)
|
||||
|
||||
func main() {
|
||||
|
||||
// check parameter count
|
||||
if len(os.Args) < 3 {
|
||||
fmt.Printf("usage: %s <dll> <sys>", os.Args[0])
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
// check parameters
|
||||
for i := 1; i < 3; i++ {
|
||||
if _, err := os.Stat(os.Args[i]); err != nil {
|
||||
fmt.Printf("could not access %s: %s", os.Args[i], err)
|
||||
os.Exit(2)
|
||||
}
|
||||
}
|
||||
|
||||
// logging
|
||||
log.Start()
|
||||
log.Info("starting Portmaster Windows Kext Test Program")
|
||||
|
||||
// init
|
||||
err := windowskext.Init(os.Args[1], os.Args[2])
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
|
||||
// start
|
||||
err = windowskext.Start()
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
|
||||
packets = make(chan packet.Packet, 1000)
|
||||
go windowskext.Handler(packets)
|
||||
go handlePackets()
|
||||
|
||||
// catch interrupt for clean shutdown
|
||||
signalCh := make(chan os.Signal)
|
||||
signal.Notify(
|
||||
signalCh,
|
||||
os.Interrupt,
|
||||
syscall.SIGHUP,
|
||||
syscall.SIGINT,
|
||||
syscall.SIGTERM,
|
||||
syscall.SIGQUIT,
|
||||
)
|
||||
<-signalCh
|
||||
fmt.Println(" <INTERRUPT>")
|
||||
log.Warning("program was interrupted, shutting down")
|
||||
|
||||
// stop
|
||||
err = windowskext.Stop()
|
||||
if err != nil {
|
||||
fmt.Printf("error stopping: %s\n", err)
|
||||
}
|
||||
|
||||
log.Info("shutdown complete")
|
||||
log.Shutdown()
|
||||
|
||||
os.Exit(0)
|
||||
}
|
||||
|
||||
func handlePackets() {
|
||||
for {
|
||||
pkt := <-packets
|
||||
|
||||
if pkt == nil {
|
||||
log.Infof("stopped handling packets")
|
||||
return
|
||||
}
|
||||
|
||||
log.Infof("received packet: %s", pkt)
|
||||
|
||||
data, err := pkt.GetPayload()
|
||||
if err != nil {
|
||||
log.Errorf("failed to get payload: %s", err)
|
||||
} else {
|
||||
log.Infof("payload is: %x", data)
|
||||
}
|
||||
|
||||
// reroute dns requests to nameserver
|
||||
if pkt.IsOutbound() && !pkt.Info().Src.Equal(pkt.Info().Dst) && pkt.Info().DstPort == 53 {
|
||||
log.Infof("rerouting %s", pkt)
|
||||
pkt.RerouteToNameserver()
|
||||
continue
|
||||
}
|
||||
|
||||
// accept all
|
||||
log.Infof("accepting %s", pkt)
|
||||
pkt.PermanentAccept()
|
||||
|
||||
}
|
||||
}
|
||||
@@ -496,18 +496,14 @@ func DecideOnLink(comm *network.Communication, link *network.Link, pkt packet.Pa
|
||||
// remoteIP
|
||||
var remoteIP net.IP
|
||||
if comm.Direction {
|
||||
remoteIP = pkt.GetIPHeader().Src
|
||||
remoteIP = pkt.Info().Src
|
||||
} else {
|
||||
remoteIP = pkt.GetIPHeader().Dst
|
||||
remoteIP = pkt.Info().Dst
|
||||
}
|
||||
|
||||
// protocol and destination port
|
||||
protocol := uint8(pkt.GetIPHeader().Protocol)
|
||||
var dstPort uint16
|
||||
tcpUDPHeader := pkt.GetTCPUDPHeader()
|
||||
if tcpUDPHeader != nil {
|
||||
dstPort = tcpUDPHeader.DstPort
|
||||
}
|
||||
protocol := uint8(pkt.Info().Protocol)
|
||||
dstPort := pkt.Info().DstPort
|
||||
|
||||
// check endpoints list
|
||||
result, reason := profileSet.CheckEndpointIP(fqdn, remoteIP, protocol, dstPort, comm.Direction)
|
||||
@@ -635,7 +631,7 @@ func DecideOnLink(comm *network.Communication, link *network.Link, pkt packet.Pa
|
||||
case "permit-domain-distinct":
|
||||
// everything already set
|
||||
case "permit-ip", "permit-ip-incoming":
|
||||
if pkt.GetIPHeader().Version == packet.IPv4 {
|
||||
if pkt.Info().Version == packet.IPv4 {
|
||||
new.Type = profile.EptIPv4
|
||||
} else {
|
||||
new.Type = profile.EptIPv6
|
||||
|
||||
24
main.go
24
main.go
@@ -39,10 +39,7 @@ func main() {
|
||||
if err == modules.ErrCleanExit {
|
||||
os.Exit(0)
|
||||
} else {
|
||||
err = modules.Shutdown()
|
||||
if err != nil {
|
||||
log.Shutdown()
|
||||
}
|
||||
modules.Shutdown()
|
||||
os.Exit(1)
|
||||
}
|
||||
}
|
||||
@@ -53,6 +50,7 @@ func main() {
|
||||
signal.Notify(
|
||||
signalCh,
|
||||
os.Interrupt,
|
||||
os.Kill,
|
||||
syscall.SIGHUP,
|
||||
syscall.SIGINT,
|
||||
syscall.SIGTERM,
|
||||
@@ -60,9 +58,18 @@ func main() {
|
||||
)
|
||||
select {
|
||||
case <-signalCh:
|
||||
|
||||
fmt.Println(" <INTERRUPT>")
|
||||
log.Warning("main: program was interrupted, shutting down.")
|
||||
|
||||
// catch signals during shutdown
|
||||
go func() {
|
||||
for {
|
||||
<-signalCh
|
||||
fmt.Println(" <INTERRUPT> again, but already shutting down")
|
||||
}
|
||||
}()
|
||||
|
||||
if printStackOnExit {
|
||||
fmt.Println("=== PRINTING STACK ===")
|
||||
pprof.Lookup("goroutine").WriteTo(os.Stdout, 1)
|
||||
@@ -70,13 +77,18 @@ func main() {
|
||||
}
|
||||
|
||||
go func() {
|
||||
time.Sleep(3 * time.Second)
|
||||
time.Sleep(5 * time.Second)
|
||||
fmt.Println("===== TAKING TOO LONG FOR SHUTDOWN - PRINTING STACK TRACES =====")
|
||||
pprof.Lookup("goroutine").WriteTo(os.Stdout, 2)
|
||||
os.Exit(1)
|
||||
}()
|
||||
modules.Shutdown()
|
||||
|
||||
err := modules.Shutdown()
|
||||
if err != nil {
|
||||
os.Exit(1)
|
||||
} else {
|
||||
os.Exit(0)
|
||||
}
|
||||
|
||||
case <-modules.ShuttingDown():
|
||||
}
|
||||
|
||||
@@ -43,7 +43,7 @@ func prep() error {
|
||||
}
|
||||
|
||||
func start() error {
|
||||
server := &dns.Server{Addr: "127.0.0.1:53", Net: "udp"}
|
||||
server := &dns.Server{Addr: "0.0.0.0:53", Net: "udp"}
|
||||
dns.HandleFunc(".", handleRequest)
|
||||
go run(server)
|
||||
return nil
|
||||
@@ -68,16 +68,47 @@ func nxDomain(w dns.ResponseWriter, query *dns.Msg) {
|
||||
|
||||
func handleRequest(w dns.ResponseWriter, query *dns.Msg) {
|
||||
|
||||
// TODO: if there are 3 request for the same domain/type in a row, delete all caches of that domain
|
||||
|
||||
// only process first question, that's how everyone does it.
|
||||
question := query.Question[0]
|
||||
fqdn := dns.Fqdn(question.Name)
|
||||
qtype := dns.Type(question.Qtype)
|
||||
|
||||
// use this to time how long it takes process this request
|
||||
// timed := time.Now()
|
||||
// defer log.Tracef("nameserver: took %s to handle request for %s%s", time.Now().Sub(timed).String(), fqdn, qtype.String())
|
||||
// get addresses
|
||||
remoteAddr, ok := w.RemoteAddr().(*net.UDPAddr)
|
||||
if !ok {
|
||||
log.Warningf("nameserver: could not get remote address of request for %s%s, ignoring", fqdn, qtype)
|
||||
return
|
||||
}
|
||||
localAddr, ok := w.RemoteAddr().(*net.UDPAddr)
|
||||
if !ok {
|
||||
log.Warningf("nameserver: could not get local address of request for %s%s, ignoring", fqdn, qtype)
|
||||
return
|
||||
}
|
||||
|
||||
// ignore external request
|
||||
if !remoteAddr.IP.Equal(localAddr.IP) {
|
||||
log.Warningf("nameserver: external request for %s%s, ignoring", fqdn, qtype)
|
||||
return
|
||||
}
|
||||
|
||||
log.Tracef("nameserver: handling request for %s%s from %s:%d", fqdn, qtype, remoteAddr.IP, remoteAddr.Port)
|
||||
|
||||
// TODO: if there are 3 request for the same domain/type in a row, delete all caches of that domain
|
||||
|
||||
// check class
|
||||
if question.Qclass != dns.ClassINET {
|
||||
// we only serve IN records, return nxdomain
|
||||
nxDomain(w, query)
|
||||
return
|
||||
}
|
||||
|
||||
// handle request for localhost
|
||||
if fqdn == "localhost." {
|
||||
m := new(dns.Msg)
|
||||
m.SetReply(query)
|
||||
m.Answer = localhostIPs
|
||||
w.WriteMsg(m)
|
||||
}
|
||||
|
||||
// check if valid domain name
|
||||
if !netutils.IsValidFqdn(fqdn) {
|
||||
@@ -96,37 +127,12 @@ func handleRequest(w dns.ResponseWriter, query *dns.Msg) {
|
||||
return
|
||||
}
|
||||
|
||||
// check class
|
||||
if question.Qclass != dns.ClassINET {
|
||||
// we only serve IN records, send NXDOMAIN
|
||||
nxDomain(w, query)
|
||||
return
|
||||
}
|
||||
|
||||
// handle request for localhost
|
||||
if fqdn == "localhost." {
|
||||
m := new(dns.Msg)
|
||||
m.SetReply(query)
|
||||
m.Answer = localhostIPs
|
||||
w.WriteMsg(m)
|
||||
}
|
||||
|
||||
// get remote address
|
||||
// start := time.Now()
|
||||
rAddr, ok := w.RemoteAddr().(*net.UDPAddr)
|
||||
// log.Tracef("nameserver: took %s to get remote address", time.Since(start))
|
||||
if !ok {
|
||||
log.Warningf("nameserver: could not get address of request, returning nxdomain")
|
||||
nxDomain(w, query)
|
||||
return
|
||||
}
|
||||
|
||||
// [1/2] use this to time how long it takes to get process info
|
||||
// timed := time.Now()
|
||||
|
||||
// get connection
|
||||
// start = time.Now()
|
||||
comm, err := network.GetCommunicationByDNSRequest(rAddr.IP, uint16(rAddr.Port), fqdn)
|
||||
comm, err := network.GetCommunicationByDNSRequest(remoteAddr.IP, uint16(remoteAddr.Port), fqdn)
|
||||
// log.Tracef("nameserver: took %s to get comms (and maybe process)", time.Since(start))
|
||||
if err != nil {
|
||||
log.Warningf("nameserver: someone is requesting %s, but could not identify process: %s, returning nxdomain", fqdn, err)
|
||||
|
||||
@@ -1,6 +1,7 @@
|
||||
package only
|
||||
|
||||
import (
|
||||
"net"
|
||||
"time"
|
||||
|
||||
"github.com/miekg/dns"
|
||||
@@ -18,7 +19,7 @@ func init() {
|
||||
}
|
||||
|
||||
func start() error {
|
||||
server := &dns.Server{Addr: "127.0.0.1:53", Net: "udp"}
|
||||
server := &dns.Server{Addr: "0.0.0.0:53", Net: "udp"}
|
||||
dns.HandleFunc(".", handleRequest)
|
||||
go run(server)
|
||||
return nil
|
||||
@@ -51,6 +52,15 @@ func handleRequest(w dns.ResponseWriter, query *dns.Msg) {
|
||||
fqdn := dns.Fqdn(question.Name)
|
||||
qtype := dns.Type(question.Qtype)
|
||||
|
||||
// debug log
|
||||
rAddr, ok := w.RemoteAddr().(*net.UDPAddr)
|
||||
if !ok {
|
||||
log.Warningf("nameserver: could not get address of request, returning nxdomain")
|
||||
nxDomain(w, query)
|
||||
return
|
||||
}
|
||||
// log.Tracef("nameserver: got request for %s%s from %s:%d", fqdn, qtype, rAddr.IP, uint16(rAddr.Port))
|
||||
|
||||
// use this to time how long it takes process this request
|
||||
// timed := time.Now()
|
||||
// defer log.Tracef("nameserver: took %s to handle request for %s%s", time.Now().Sub(timed).String(), fqdn, qtype.String())
|
||||
@@ -65,7 +75,7 @@ func handleRequest(w dns.ResponseWriter, query *dns.Msg) {
|
||||
// check for possible DNS tunneling / data transmission
|
||||
// TODO: improve this
|
||||
lms := algs.LmsScoreOfDomain(fqdn)
|
||||
// log.Tracef("nameserver: domain %s has lms score of %f", fqdn, lms)
|
||||
log.Tracef("nameserver: domain %s has lms score of %f", fqdn, lms)
|
||||
if lms < 10 {
|
||||
log.Tracef("nameserver: possible data tunnel: %s has lms score of %f, returning nxdomain", fqdn, lms)
|
||||
nxDomain(w, query)
|
||||
@@ -85,7 +95,7 @@ func handleRequest(w dns.ResponseWriter, query *dns.Msg) {
|
||||
// log.Tracef("nameserver: took %s to get intel and RRs", time.Since(start))
|
||||
if rrCache == nil {
|
||||
// TODO: analyze nxdomain requests, malware could be trying DGA-domains
|
||||
log.Infof("nameserver: %s is nxdomain", fqdn)
|
||||
log.Infof("nameserver: %s%s is nxdomain", fqdn, qtype)
|
||||
nxDomain(w, query)
|
||||
return
|
||||
}
|
||||
@@ -97,4 +107,5 @@ func handleRequest(w dns.ResponseWriter, query *dns.Msg) {
|
||||
m.Ns = rrCache.Ns
|
||||
m.Extra = rrCache.Extra
|
||||
w.WriteMsg(m)
|
||||
log.Tracef("nameserver: replied to request for %s%s from %s:%d", fqdn, qtype, rAddr.IP, uint16(rAddr.Port))
|
||||
}
|
||||
|
||||
@@ -154,7 +154,7 @@ func GetCommunicationByFirstPacket(pkt packet.Packet) (*Communication, error) {
|
||||
|
||||
// Incoming
|
||||
if direction {
|
||||
switch netutils.ClassifyIP(pkt.GetIPHeader().Src) {
|
||||
switch netutils.ClassifyIP(pkt.Info().Src) {
|
||||
case netutils.HostLocal:
|
||||
domain = IncomingHost
|
||||
case netutils.LinkLocal, netutils.SiteLocal, netutils.LocalMulticast:
|
||||
@@ -186,7 +186,7 @@ func GetCommunicationByFirstPacket(pkt packet.Packet) (*Communication, error) {
|
||||
if err != nil {
|
||||
// if no domain could be found, it must be a direct connection (ie. no DNS)
|
||||
|
||||
switch netutils.ClassifyIP(pkt.GetIPHeader().Dst) {
|
||||
switch netutils.ClassifyIP(pkt.Info().Dst) {
|
||||
case netutils.HostLocal:
|
||||
domain = PeerHost
|
||||
case netutils.LinkLocal, netutils.SiteLocal, netutils.LocalMulticast:
|
||||
|
||||
@@ -3,6 +3,7 @@
|
||||
package packet
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"net"
|
||||
)
|
||||
@@ -43,6 +44,10 @@ const (
|
||||
STOP
|
||||
)
|
||||
|
||||
var (
|
||||
ErrFailedToLoadPayload = errors.New("could not load packet payload")
|
||||
)
|
||||
|
||||
// Returns the byte size of the ip, IPv4 = 4 bytes, IPv6 = 16
|
||||
func (v IPVersion) ByteSize() int {
|
||||
switch v {
|
||||
@@ -92,58 +97,59 @@ func (v Verdict) String() string {
|
||||
return fmt.Sprintf("<unsupported verdict, %d>", uint8(v))
|
||||
}
|
||||
|
||||
type IPHeader struct {
|
||||
// PacketInfo holds IP and TCP/UDP header information
|
||||
type PacketInfo struct {
|
||||
Direction bool
|
||||
InTunnel bool
|
||||
|
||||
Version IPVersion
|
||||
|
||||
Tos, TTL uint8
|
||||
Protocol IPProtocol
|
||||
Src, Dst net.IP
|
||||
}
|
||||
|
||||
type TCPUDPHeader struct {
|
||||
Protocol IPProtocol
|
||||
SrcPort, DstPort uint16
|
||||
Checksum uint16 //not implemented
|
||||
}
|
||||
|
||||
type PacketBase struct {
|
||||
info PacketInfo
|
||||
linkID string
|
||||
Direction bool
|
||||
InTunnel bool
|
||||
Payload []byte
|
||||
*IPHeader
|
||||
*TCPUDPHeader
|
||||
}
|
||||
|
||||
func (pkt *PacketBase) GetIPHeader() *IPHeader {
|
||||
return pkt.IPHeader
|
||||
func (pkt *PacketBase) Info() *PacketInfo {
|
||||
return &pkt.info
|
||||
}
|
||||
|
||||
func (pkt *PacketBase) GetTCPUDPHeader() *TCPUDPHeader {
|
||||
return pkt.TCPUDPHeader
|
||||
}
|
||||
|
||||
func (pkt *PacketBase) GetPayload() []byte {
|
||||
return pkt.Payload
|
||||
func (pkt *PacketBase) SetPacketInfo(packetInfo PacketInfo) {
|
||||
pkt.info = packetInfo
|
||||
}
|
||||
|
||||
func (pkt *PacketBase) SetInbound() {
|
||||
pkt.Direction = true
|
||||
pkt.info.Direction = true
|
||||
}
|
||||
|
||||
func (pkt *PacketBase) SetOutbound() {
|
||||
pkt.Direction = false
|
||||
pkt.info.Direction = false
|
||||
}
|
||||
|
||||
func (pkt *PacketBase) IsInbound() bool {
|
||||
return pkt.Direction
|
||||
return pkt.info.Direction
|
||||
}
|
||||
|
||||
func (pkt *PacketBase) IsOutbound() bool {
|
||||
return !pkt.Direction
|
||||
return !pkt.info.Direction
|
||||
}
|
||||
|
||||
func (pkt *PacketBase) IPVersion() IPVersion {
|
||||
return pkt.Version
|
||||
func (pkt *PacketBase) HasPorts() bool {
|
||||
switch pkt.info.Protocol {
|
||||
case TCP:
|
||||
return true
|
||||
case UDP:
|
||||
return true
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
func (pkt *PacketBase) GetPayload() ([]byte, error) {
|
||||
return pkt.Payload, ErrFailedToLoadPayload
|
||||
}
|
||||
|
||||
func (pkt *PacketBase) GetLinkID() string {
|
||||
@@ -154,82 +160,63 @@ func (pkt *PacketBase) GetLinkID() string {
|
||||
}
|
||||
|
||||
func (pkt *PacketBase) createLinkID() {
|
||||
if pkt.IPHeader.Protocol == TCP || pkt.IPHeader.Protocol == UDP {
|
||||
if pkt.Direction {
|
||||
pkt.linkID = fmt.Sprintf("%d-%s-%d-%s-%d", pkt.Protocol, pkt.Dst, pkt.DstPort, pkt.Src, pkt.SrcPort)
|
||||
if pkt.info.Protocol == TCP || pkt.info.Protocol == UDP {
|
||||
if pkt.info.Direction {
|
||||
pkt.linkID = fmt.Sprintf("%d-%s-%d-%s-%d", pkt.info.Protocol, pkt.info.Dst, pkt.info.DstPort, pkt.info.Src, pkt.info.SrcPort)
|
||||
} else {
|
||||
pkt.linkID = fmt.Sprintf("%d-%s-%d-%s-%d", pkt.Protocol, pkt.Src, pkt.SrcPort, pkt.Dst, pkt.DstPort)
|
||||
pkt.linkID = fmt.Sprintf("%d-%s-%d-%s-%d", pkt.info.Protocol, pkt.info.Src, pkt.info.SrcPort, pkt.info.Dst, pkt.info.DstPort)
|
||||
}
|
||||
} else {
|
||||
if pkt.Direction {
|
||||
pkt.linkID = fmt.Sprintf("%d-%s-%s", pkt.Protocol, pkt.Dst, pkt.Src)
|
||||
if pkt.info.Direction {
|
||||
pkt.linkID = fmt.Sprintf("%d-%s-%s", pkt.info.Protocol, pkt.info.Dst, pkt.info.Src)
|
||||
} else {
|
||||
pkt.linkID = fmt.Sprintf("%d-%s-%s", pkt.Protocol, pkt.Src, pkt.Dst)
|
||||
pkt.linkID = fmt.Sprintf("%d-%s-%s", pkt.info.Protocol, pkt.info.Src, pkt.info.Dst)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Matches checks if a the packet matches a given endpoint (remote or local) in protocol, network and port.
|
||||
//
|
||||
// Comparison matrix:
|
||||
// IN OUT
|
||||
// Local Dst Src
|
||||
// Remote Src Dst
|
||||
//
|
||||
func (pkt *PacketBase) MatchesAddress(endpoint bool, protocol IPProtocol, network *net.IPNet, port uint16) bool {
|
||||
if pkt.Protocol != protocol {
|
||||
func (pkt *PacketBase) MatchesAddress(remote bool, protocol IPProtocol, network *net.IPNet, port uint16) bool {
|
||||
if pkt.info.Protocol != protocol {
|
||||
return false
|
||||
}
|
||||
if pkt.Direction != endpoint {
|
||||
if !network.Contains(pkt.Src) {
|
||||
if pkt.info.Direction != remote {
|
||||
if !network.Contains(pkt.info.Src) {
|
||||
return false
|
||||
}
|
||||
if port != 0 && pkt.TCPUDPHeader != nil {
|
||||
if pkt.SrcPort != port {
|
||||
if pkt.info.SrcPort != port {
|
||||
return false
|
||||
}
|
||||
}
|
||||
} else {
|
||||
if !network.Contains(pkt.Dst) {
|
||||
if !network.Contains(pkt.info.Dst) {
|
||||
return false
|
||||
}
|
||||
if port != 0 && pkt.TCPUDPHeader != nil {
|
||||
if pkt.DstPort != port {
|
||||
if pkt.info.DstPort != port {
|
||||
return false
|
||||
}
|
||||
}
|
||||
}
|
||||
return true
|
||||
}
|
||||
|
||||
func (pkt *PacketBase) MatchesIP(endpoint bool, network *net.IPNet) bool {
|
||||
if pkt.Direction != endpoint {
|
||||
if network.Contains(pkt.Src) {
|
||||
if pkt.info.Direction != endpoint {
|
||||
if network.Contains(pkt.info.Src) {
|
||||
return true
|
||||
}
|
||||
} else {
|
||||
if network.Contains(pkt.Dst) {
|
||||
if network.Contains(pkt.info.Dst) {
|
||||
return true
|
||||
}
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
// func (pkt *PacketBase) Accept() error {
|
||||
// return nil
|
||||
// }
|
||||
//
|
||||
// func (pkt *PacketBase) Drop() error {
|
||||
// return nil
|
||||
// }
|
||||
//
|
||||
// func (pkt *PacketBase) Block() error {
|
||||
// return nil
|
||||
// }
|
||||
//
|
||||
// func (pkt *PacketBase) Verdict(verdict Verdict) error {
|
||||
// return nil
|
||||
// }
|
||||
|
||||
// FORMATTING
|
||||
|
||||
func (pkt *PacketBase) String() string {
|
||||
@@ -238,45 +225,45 @@ func (pkt *PacketBase) String() string {
|
||||
|
||||
// FmtPacket returns the most important information about the packet as a string
|
||||
func (pkt *PacketBase) FmtPacket() string {
|
||||
if pkt.IPHeader.Protocol == TCP || pkt.IPHeader.Protocol == UDP {
|
||||
if pkt.Direction {
|
||||
return fmt.Sprintf("IN %s %s:%d <-> %s:%d", pkt.Protocol, pkt.Dst, pkt.DstPort, pkt.Src, pkt.SrcPort)
|
||||
if pkt.info.Protocol == TCP || pkt.info.Protocol == UDP {
|
||||
if pkt.info.Direction {
|
||||
return fmt.Sprintf("IN %s %s:%d <-> %s:%d", pkt.info.Protocol, pkt.info.Dst, pkt.info.DstPort, pkt.info.Src, pkt.info.SrcPort)
|
||||
}
|
||||
return fmt.Sprintf("OUT %s %s:%d <-> %s:%d", pkt.Protocol, pkt.Src, pkt.SrcPort, pkt.Dst, pkt.DstPort)
|
||||
return fmt.Sprintf("OUT %s %s:%d <-> %s:%d", pkt.info.Protocol, pkt.info.Src, pkt.info.SrcPort, pkt.info.Dst, pkt.info.DstPort)
|
||||
}
|
||||
if pkt.Direction {
|
||||
return fmt.Sprintf("IN %s %s <-> %s", pkt.Protocol, pkt.Dst, pkt.Src)
|
||||
if pkt.info.Direction {
|
||||
return fmt.Sprintf("IN %s %s <-> %s", pkt.info.Protocol, pkt.info.Dst, pkt.info.Src)
|
||||
}
|
||||
return fmt.Sprintf("OUT %s %s <-> %s", pkt.Protocol, pkt.Src, pkt.Dst)
|
||||
return fmt.Sprintf("OUT %s %s <-> %s", pkt.info.Protocol, pkt.info.Src, pkt.info.Dst)
|
||||
}
|
||||
|
||||
// FmtProtocol returns the protocol as a string
|
||||
func (pkt *PacketBase) FmtProtocol() string {
|
||||
return pkt.IPHeader.Protocol.String()
|
||||
return pkt.info.Protocol.String()
|
||||
}
|
||||
|
||||
// FmtRemoteIP returns the remote IP address as a string
|
||||
func (pkt *PacketBase) FmtRemoteIP() string {
|
||||
if pkt.Direction {
|
||||
return pkt.IPHeader.Src.String()
|
||||
if pkt.info.Direction {
|
||||
return pkt.info.Src.String()
|
||||
}
|
||||
return pkt.IPHeader.Dst.String()
|
||||
return pkt.info.Dst.String()
|
||||
}
|
||||
|
||||
// FmtRemotePort returns the remote port as a string
|
||||
func (pkt *PacketBase) FmtRemotePort() string {
|
||||
if pkt.TCPUDPHeader != nil {
|
||||
if pkt.Direction {
|
||||
return fmt.Sprintf("%d", pkt.TCPUDPHeader.SrcPort)
|
||||
if pkt.info.SrcPort != 0 {
|
||||
if pkt.info.Direction {
|
||||
return fmt.Sprintf("%d", pkt.info.SrcPort)
|
||||
}
|
||||
return fmt.Sprintf("%d", pkt.TCPUDPHeader.DstPort)
|
||||
return fmt.Sprintf("%d", pkt.info.DstPort)
|
||||
}
|
||||
return "-"
|
||||
}
|
||||
|
||||
// FmtRemoteAddress returns the full remote address (protocol, IP, port) as a string
|
||||
func (pkt *PacketBase) FmtRemoteAddress() string {
|
||||
return fmt.Sprintf("%s:%s:%s", pkt.IPHeader.Protocol.String(), pkt.FmtRemoteIP(), pkt.FmtRemotePort())
|
||||
return fmt.Sprintf("%s:%s:%s", pkt.info.Protocol.String(), pkt.FmtRemoteIP(), pkt.FmtRemotePort())
|
||||
}
|
||||
|
||||
// Packet is an interface to a network packet to provide object behaviour the same across all systems
|
||||
@@ -292,15 +279,15 @@ type Packet interface {
|
||||
RerouteToTunnel() error
|
||||
|
||||
// INFO
|
||||
GetIPHeader() *IPHeader
|
||||
GetTCPUDPHeader() *TCPUDPHeader
|
||||
GetPayload() []byte
|
||||
Info() *PacketInfo
|
||||
SetPacketInfo(PacketInfo)
|
||||
IsInbound() bool
|
||||
IsOutbound() bool
|
||||
SetInbound()
|
||||
SetOutbound()
|
||||
HasPorts() bool
|
||||
GetPayload() ([]byte, error)
|
||||
GetLinkID() string
|
||||
IPVersion() IPVersion
|
||||
|
||||
// MATCHING
|
||||
MatchesAddress(bool, IPProtocol, *net.IPNet, uint16) bool
|
||||
|
||||
91
network/packet/parse.go
Normal file
91
network/packet/parse.go
Normal file
@@ -0,0 +1,91 @@
|
||||
package packet
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
|
||||
"github.com/google/gopacket"
|
||||
"github.com/google/gopacket/layers"
|
||||
)
|
||||
|
||||
// Parse parses an IP packet and saves the information in the given packet object.
|
||||
func Parse(packetData []byte, packet *PacketBase) error {
|
||||
|
||||
var parsedPacket gopacket.Packet
|
||||
|
||||
if len(packetData) == 0 {
|
||||
return errors.New("empty packet")
|
||||
}
|
||||
|
||||
switch packetData[0] >> 4 {
|
||||
case 4:
|
||||
parsedPacket = gopacket.NewPacket(packetData, layers.LayerTypeIPv4, gopacket.DecodeOptions{Lazy: true, NoCopy: true})
|
||||
if ipv4Layer := parsedPacket.Layer(layers.LayerTypeIPv4); ipv4Layer != nil {
|
||||
ipv4, _ := ipv4Layer.(*layers.IPv4)
|
||||
packet.info.Version = IPv4
|
||||
packet.info.Protocol = IPProtocol(ipv4.Protocol)
|
||||
packet.info.Src = ipv4.SrcIP
|
||||
packet.info.Dst = ipv4.DstIP
|
||||
} else {
|
||||
var err error
|
||||
if errLayer := parsedPacket.ErrorLayer(); errLayer != nil {
|
||||
err = errLayer.Error()
|
||||
}
|
||||
return fmt.Errorf("failed to parse IPv4 packet: %s", err)
|
||||
}
|
||||
case 6:
|
||||
parsedPacket = gopacket.NewPacket(packetData, layers.LayerTypeIPv6, gopacket.DecodeOptions{Lazy: true, NoCopy: true})
|
||||
if ipv6Layer := parsedPacket.Layer(layers.LayerTypeIPv6); ipv6Layer != nil {
|
||||
ipv6, _ := ipv6Layer.(*layers.IPv6)
|
||||
packet.info.Version = IPv6
|
||||
packet.info.Protocol = IPProtocol(ipv6.NextHeader)
|
||||
packet.info.Src = ipv6.SrcIP
|
||||
packet.info.Dst = ipv6.DstIP
|
||||
} else {
|
||||
var err error
|
||||
if errLayer := parsedPacket.ErrorLayer(); errLayer != nil {
|
||||
err = errLayer.Error()
|
||||
}
|
||||
return fmt.Errorf("failed to parse IPv6 packet: %s", err)
|
||||
}
|
||||
default:
|
||||
return errors.New("unknown IP version")
|
||||
}
|
||||
|
||||
switch packet.info.Protocol {
|
||||
case TCP:
|
||||
if tcpLayer := parsedPacket.Layer(layers.LayerTypeTCP); tcpLayer != nil {
|
||||
tcp, _ := tcpLayer.(*layers.TCP)
|
||||
packet.info.SrcPort = uint16(tcp.SrcPort)
|
||||
packet.info.DstPort = uint16(tcp.DstPort)
|
||||
} else {
|
||||
var err error
|
||||
if errLayer := parsedPacket.ErrorLayer(); errLayer != nil {
|
||||
err = errLayer.Error()
|
||||
}
|
||||
return fmt.Errorf("could not parse TCP layer: %s", err)
|
||||
}
|
||||
case UDP:
|
||||
if udpLayer := parsedPacket.Layer(layers.LayerTypeUDP); udpLayer != nil {
|
||||
udp, _ := udpLayer.(*layers.UDP)
|
||||
packet.info.SrcPort = uint16(udp.SrcPort)
|
||||
packet.info.DstPort = uint16(udp.DstPort)
|
||||
} else {
|
||||
var err error
|
||||
if errLayer := parsedPacket.ErrorLayer(); errLayer != nil {
|
||||
err = errLayer.Error()
|
||||
}
|
||||
return fmt.Errorf("could not parse UDP layer: %s", err)
|
||||
}
|
||||
}
|
||||
|
||||
if appLayer := parsedPacket.ApplicationLayer(); appLayer != nil {
|
||||
packet.Payload = appLayer.Payload()
|
||||
}
|
||||
|
||||
if errLayer := parsedPacket.ErrorLayer(); errLayer != nil {
|
||||
return errLayer.Error()
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
@@ -3,7 +3,7 @@
|
||||
package network
|
||||
|
||||
// Verdict describes the decision made about a connection or link.
|
||||
type Verdict uint8
|
||||
type Verdict int8
|
||||
|
||||
// List of values a Status can have
|
||||
const (
|
||||
|
||||
@@ -16,7 +16,7 @@ const (
|
||||
// GetUnknownCommunication returns the connection to a packet of unknown owner.
|
||||
func GetUnknownCommunication(pkt packet.Packet) (*Communication, error) {
|
||||
if pkt.IsInbound() {
|
||||
switch netutils.ClassifyIP(pkt.GetIPHeader().Src) {
|
||||
switch netutils.ClassifyIP(pkt.Info().Src) {
|
||||
case netutils.HostLocal:
|
||||
return getOrCreateUnknownCommunication(pkt, IncomingHost)
|
||||
case netutils.LinkLocal, netutils.SiteLocal, netutils.LocalMulticast:
|
||||
@@ -28,7 +28,7 @@ func GetUnknownCommunication(pkt packet.Packet) (*Communication, error) {
|
||||
}
|
||||
}
|
||||
|
||||
switch netutils.ClassifyIP(pkt.GetIPHeader().Dst) {
|
||||
switch netutils.ClassifyIP(pkt.Info().Dst) {
|
||||
case netutils.HostLocal:
|
||||
return getOrCreateUnknownCommunication(pkt, PeerHost)
|
||||
case netutils.LinkLocal, netutils.SiteLocal, netutils.LocalMulticast:
|
||||
|
||||
@@ -5,6 +5,7 @@ import (
|
||||
"io"
|
||||
"os"
|
||||
"os/exec"
|
||||
"runtime"
|
||||
"strings"
|
||||
|
||||
"github.com/spf13/cobra"
|
||||
@@ -100,13 +101,18 @@ func run(identifier string, cmd *cobra.Command, filterDatabaseFlag bool) error {
|
||||
}
|
||||
|
||||
// check permission
|
||||
if runtime.GOOS != "windows" {
|
||||
info, err := os.Stat(file.Path())
|
||||
if err != nil {
|
||||
return fmt.Errorf("%s failed to get file info on %s: %s", logPrefix, file.Path(), err)
|
||||
}
|
||||
if info.Mode() != 0755 {
|
||||
err := os.Chmod(file.Path(), 0755)
|
||||
if err != nil {
|
||||
return fmt.Errorf("%s failed to set exec permissions on %s: %s", logPrefix, file.Path(), err)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fmt.Printf("%s starting %s %s\n", logPrefix, file.Path(), strings.Join(args, " "))
|
||||
// os.Exit(0)
|
||||
|
||||
@@ -5,6 +5,7 @@ import (
|
||||
"io"
|
||||
"os"
|
||||
"path/filepath"
|
||||
"runtime"
|
||||
|
||||
"github.com/Safing/portbase/info"
|
||||
"github.com/Safing/portmaster/updates"
|
||||
@@ -51,14 +52,18 @@ func doSelfUpgrade(file *updates.File) error {
|
||||
}
|
||||
|
||||
// check permission
|
||||
if runtime.GOOS != "windows" {
|
||||
info, err := os.Stat(dst)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to get file info on %s: %s", dst, err)
|
||||
}
|
||||
if info.Mode() != 0755 {
|
||||
err := os.Chmod(dst, 0755)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed to set permissions on %s: %s", dst, err)
|
||||
}
|
||||
}
|
||||
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
|
||||
@@ -22,30 +22,30 @@ func GetPidByPacket(pkt packet.Packet) (pid int, direction bool, err error) {
|
||||
var remoteIP net.IP
|
||||
var remotePort uint16
|
||||
if pkt.IsInbound() {
|
||||
localIP = pkt.GetIPHeader().Dst
|
||||
remoteIP = pkt.GetIPHeader().Src
|
||||
localIP = pkt.Info().Dst
|
||||
remoteIP = pkt.Info().Src
|
||||
} else {
|
||||
localIP = pkt.GetIPHeader().Src
|
||||
remoteIP = pkt.GetIPHeader().Dst
|
||||
localIP = pkt.Info().Src
|
||||
remoteIP = pkt.Info().Dst
|
||||
}
|
||||
if pkt.GetIPHeader().Protocol == packet.TCP || pkt.GetIPHeader().Protocol == packet.UDP {
|
||||
if pkt.HasPorts() {
|
||||
if pkt.IsInbound() {
|
||||
localPort = pkt.GetTCPUDPHeader().DstPort
|
||||
remotePort = pkt.GetTCPUDPHeader().SrcPort
|
||||
localPort = pkt.Info().DstPort
|
||||
remotePort = pkt.Info().SrcPort
|
||||
} else {
|
||||
localPort = pkt.GetTCPUDPHeader().SrcPort
|
||||
remotePort = pkt.GetTCPUDPHeader().DstPort
|
||||
localPort = pkt.Info().SrcPort
|
||||
remotePort = pkt.Info().DstPort
|
||||
}
|
||||
}
|
||||
|
||||
switch {
|
||||
case pkt.GetIPHeader().Protocol == packet.TCP && pkt.IPVersion() == packet.IPv4:
|
||||
case pkt.Info().Protocol == packet.TCP && pkt.Info().Version == packet.IPv4:
|
||||
return getTCP4PacketInfo(localIP, localPort, remoteIP, remotePort, pkt.IsInbound())
|
||||
case pkt.GetIPHeader().Protocol == packet.UDP && pkt.IPVersion() == packet.IPv4:
|
||||
case pkt.Info().Protocol == packet.UDP && pkt.Info().Version == packet.IPv4:
|
||||
return getUDP4PacketInfo(localIP, localPort, remoteIP, remotePort, pkt.IsInbound())
|
||||
case pkt.GetIPHeader().Protocol == packet.TCP && pkt.IPVersion() == packet.IPv6:
|
||||
case pkt.Info().Protocol == packet.TCP && pkt.Info().Version == packet.IPv6:
|
||||
return getTCP6PacketInfo(localIP, localPort, remoteIP, remotePort, pkt.IsInbound())
|
||||
case pkt.GetIPHeader().Protocol == packet.UDP && pkt.IPVersion() == packet.IPv6:
|
||||
case pkt.Info().Protocol == packet.UDP && pkt.Info().Version == packet.IPv6:
|
||||
return getUDP6PacketInfo(localIP, localPort, remoteIP, remotePort, pkt.IsInbound())
|
||||
default:
|
||||
return -1, false, errors.New("unsupported protocol for finding process")
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
package process
|
||||
|
||||
import (
|
||||
"github.com/Safing/safing-core/process/iphelper"
|
||||
"github.com/Safing/portmaster/process/iphelper"
|
||||
)
|
||||
|
||||
var (
|
||||
|
||||
@@ -6,6 +6,7 @@ import (
|
||||
"fmt"
|
||||
"net"
|
||||
"sync"
|
||||
"time"
|
||||
)
|
||||
|
||||
var (
|
||||
@@ -21,6 +22,8 @@ var (
|
||||
|
||||
ipHelper *IPHelper
|
||||
lock sync.RWMutex
|
||||
|
||||
waitTime = 15 * time.Millisecond
|
||||
)
|
||||
|
||||
func checkIPHelper() (err error) {
|
||||
@@ -34,11 +37,15 @@ func checkIPHelper() (err error) {
|
||||
func GetTCP4PacketInfo(localIP net.IP, localPort uint16, remoteIP net.IP, remotePort uint16, pktDirection bool) (pid int, direction bool, err error) {
|
||||
|
||||
// search
|
||||
pid, direction = search(tcp4Connections, tcp4Listeners, localIP, remoteIP, localPort, remotePort, pktDirection)
|
||||
pid, _ = search(tcp4Connections, tcp4Listeners, localIP, remoteIP, localPort, remotePort, pktDirection)
|
||||
if pid >= 0 {
|
||||
return
|
||||
return pid, pktDirection, nil
|
||||
}
|
||||
|
||||
for i := 0; i < 3; i++ {
|
||||
// give kernel some time, then try again
|
||||
// log.Tracef("process: giving kernel some time to think")
|
||||
|
||||
// if unable to find, refresh
|
||||
lock.Lock()
|
||||
err = checkIPHelper()
|
||||
@@ -47,26 +54,33 @@ func GetTCP4PacketInfo(localIP net.IP, localPort uint16, remoteIP net.IP, remote
|
||||
}
|
||||
lock.Unlock()
|
||||
if err != nil {
|
||||
return -1, direction, err
|
||||
return -1, pktDirection, err
|
||||
}
|
||||
|
||||
// search
|
||||
pid, direction = search(tcp4Connections, tcp4Listeners, localIP, remoteIP, localPort, remotePort, pktDirection)
|
||||
pid, _ = search(tcp4Connections, tcp4Listeners, localIP, remoteIP, localPort, remotePort, pktDirection)
|
||||
if pid >= 0 {
|
||||
return
|
||||
return pid, pktDirection, nil
|
||||
}
|
||||
|
||||
return -1, direction, nil
|
||||
time.Sleep(waitTime)
|
||||
}
|
||||
|
||||
return -1, pktDirection, nil
|
||||
}
|
||||
|
||||
func GetTCP6PacketInfo(localIP net.IP, localPort uint16, remoteIP net.IP, remotePort uint16, pktDirection bool) (pid int, direction bool, err error) {
|
||||
|
||||
// search
|
||||
pid, direction = search(tcp6Connections, tcp6Listeners, localIP, remoteIP, localPort, remotePort, pktDirection)
|
||||
pid, _ = search(tcp6Connections, tcp6Listeners, localIP, remoteIP, localPort, remotePort, pktDirection)
|
||||
if pid >= 0 {
|
||||
return
|
||||
return pid, pktDirection, nil
|
||||
}
|
||||
|
||||
for i := 0; i < 3; i++ {
|
||||
// give kernel some time, then try again
|
||||
// log.Tracef("process: giving kernel some time to think")
|
||||
|
||||
// if unable to find, refresh
|
||||
lock.Lock()
|
||||
err = checkIPHelper()
|
||||
@@ -75,16 +89,19 @@ func GetTCP6PacketInfo(localIP net.IP, localPort uint16, remoteIP net.IP, remote
|
||||
}
|
||||
lock.Unlock()
|
||||
if err != nil {
|
||||
return -1, direction, err
|
||||
return -1, pktDirection, err
|
||||
}
|
||||
|
||||
// search
|
||||
pid, direction = search(tcp6Connections, tcp6Listeners, localIP, remoteIP, localPort, remotePort, pktDirection)
|
||||
pid, _ = search(tcp6Connections, tcp6Listeners, localIP, remoteIP, localPort, remotePort, pktDirection)
|
||||
if pid >= 0 {
|
||||
return
|
||||
return pid, pktDirection, nil
|
||||
}
|
||||
|
||||
return -1, direction, nil
|
||||
time.Sleep(waitTime)
|
||||
}
|
||||
|
||||
return -1, pktDirection, nil
|
||||
}
|
||||
|
||||
func GetUDP4PacketInfo(localIP net.IP, localPort uint16, remoteIP net.IP, remotePort uint16, pktDirection bool) (pid int, direction bool, err error) {
|
||||
@@ -95,6 +112,10 @@ func GetUDP4PacketInfo(localIP net.IP, localPort uint16, remoteIP net.IP, remote
|
||||
return pid, pktDirection, nil
|
||||
}
|
||||
|
||||
for i := 0; i < 3; i++ {
|
||||
// give kernel some time, then try again
|
||||
// log.Tracef("process: giving kernel some time to think")
|
||||
|
||||
// if unable to find, refresh
|
||||
lock.Lock()
|
||||
err = checkIPHelper()
|
||||
@@ -112,6 +133,9 @@ func GetUDP4PacketInfo(localIP net.IP, localPort uint16, remoteIP net.IP, remote
|
||||
return pid, pktDirection, nil
|
||||
}
|
||||
|
||||
time.Sleep(waitTime)
|
||||
}
|
||||
|
||||
return -1, pktDirection, nil
|
||||
}
|
||||
|
||||
@@ -123,6 +147,10 @@ func GetUDP6PacketInfo(localIP net.IP, localPort uint16, remoteIP net.IP, remote
|
||||
return pid, pktDirection, nil
|
||||
}
|
||||
|
||||
for i := 0; i < 3; i++ {
|
||||
// give kernel some time, then try again
|
||||
// log.Tracef("process: giving kernel some time to think")
|
||||
|
||||
// if unable to find, refresh
|
||||
lock.Lock()
|
||||
err = checkIPHelper()
|
||||
@@ -140,6 +168,9 @@ func GetUDP6PacketInfo(localIP net.IP, localPort uint16, remoteIP net.IP, remote
|
||||
return pid, pktDirection, nil
|
||||
}
|
||||
|
||||
time.Sleep(waitTime)
|
||||
}
|
||||
|
||||
return -1, pktDirection, nil
|
||||
}
|
||||
|
||||
@@ -190,8 +221,8 @@ func searchListeners(list []*connectionEntry, localIP net.IP, localPort uint16)
|
||||
|
||||
for _, entry := range list {
|
||||
if localPort == entry.localPort &&
|
||||
entry.localIP == nil || // nil IP means zero IP, see tables.go
|
||||
localIP.Equal(entry.localIP) {
|
||||
(entry.localIP == nil || // nil IP means zero IP, see tables.go
|
||||
localIP.Equal(entry.localIP)) {
|
||||
return entry.pid
|
||||
}
|
||||
}
|
||||
|
||||
@@ -3,7 +3,6 @@
|
||||
package iphelper
|
||||
|
||||
import (
|
||||
"encoding/binary"
|
||||
"errors"
|
||||
"fmt"
|
||||
"net"
|
||||
@@ -165,19 +164,16 @@ func (ipHelper *IPHelper) GetTables(protocol uint8, ipVersion uint8) (connection
|
||||
new.pid = int(row.owningPid)
|
||||
|
||||
// local
|
||||
new.localIP = make([]byte, 4)
|
||||
binary.LittleEndian.PutUint32(new.localIP, row.localAddr)
|
||||
if row.localAddr != 0 {
|
||||
new.localIP = convertIPv4(row.localAddr)
|
||||
}
|
||||
new.localPort = uint16(row.localPort>>8 | row.localPort<<8)
|
||||
|
||||
// remote
|
||||
if row.state == iphelper_TCP_STATE_LISTEN {
|
||||
if new.localIP.Equal(net.IPv4zero) {
|
||||
new.localIP = nil
|
||||
}
|
||||
listeners = append(listeners, new)
|
||||
} else {
|
||||
new.remoteIP = make([]byte, 4)
|
||||
binary.LittleEndian.PutUint32(new.remoteIP, row.remoteAddr)
|
||||
new.remoteIP = convertIPv4(row.remoteAddr)
|
||||
new.remotePort = uint16(row.remotePort>>8 | row.remotePort<<8)
|
||||
connections = append(connections, new)
|
||||
}
|
||||
@@ -229,8 +225,7 @@ func (ipHelper *IPHelper) GetTables(protocol uint8, ipVersion uint8) (connection
|
||||
if row.localAddr == 0 {
|
||||
listeners = append(listeners, new)
|
||||
} else {
|
||||
new.localIP = make([]byte, 4)
|
||||
binary.LittleEndian.PutUint32(new.localIP, row.localAddr)
|
||||
new.localIP = convertIPv4(row.localAddr)
|
||||
connections = append(connections, new)
|
||||
}
|
||||
}
|
||||
@@ -261,3 +256,12 @@ func (ipHelper *IPHelper) GetTables(protocol uint8, ipVersion uint8) (connection
|
||||
|
||||
return connections, listeners, nil
|
||||
}
|
||||
|
||||
func convertIPv4(input uint32) net.IP {
|
||||
return net.IPv4(
|
||||
uint8(input&0xFF),
|
||||
uint8(input>>8&0xFF),
|
||||
uint8(input>>16&0xFF),
|
||||
uint8(input>>24&0xFF),
|
||||
)
|
||||
}
|
||||
|
||||
@@ -5,7 +5,7 @@ package main
|
||||
import (
|
||||
"fmt"
|
||||
|
||||
"github.com/Safing/safing-core/process/iphelper"
|
||||
"github.com/Safing/portmaster/process/iphelper"
|
||||
)
|
||||
|
||||
func main() {
|
||||
|
||||
@@ -5,12 +5,12 @@ import "strings"
|
||||
// IsUser returns whether the process is run by a normal user.
|
||||
func (m *Process) IsUser() bool {
|
||||
return m.Pid != 4 && // Kernel
|
||||
!strings.HasPrefix(m.UserName, "NT-") // NT-Authority (localized!)
|
||||
!strings.HasPrefix(m.UserName, "NT") // NT-Authority (localized!)
|
||||
}
|
||||
|
||||
// IsAdmin returns whether the process is run by an admin user.
|
||||
func (m *Process) IsAdmin() bool {
|
||||
return strings.HasPrefix(m.UserName, "NT-") // NT-Authority (localized!)
|
||||
return strings.HasPrefix(m.UserName, "NT") // NT-Authority (localized!)
|
||||
}
|
||||
|
||||
// IsSystem returns whether the process is run by the operating system.
|
||||
|
||||
6
profile/const_windows.go
Normal file
6
profile/const_windows.go
Normal file
@@ -0,0 +1,6 @@
|
||||
package profile
|
||||
|
||||
// OS Identifier
|
||||
const (
|
||||
osIdentifier = PlatformWindows
|
||||
)
|
||||
@@ -9,6 +9,7 @@ import (
|
||||
"os"
|
||||
"path"
|
||||
"path/filepath"
|
||||
"runtime"
|
||||
"time"
|
||||
|
||||
"github.com/google/renameio"
|
||||
@@ -70,10 +71,12 @@ func fetchFile(realFilepath, updateFilepath string, tries int) error {
|
||||
return fmt.Errorf("updates: failed to finalize file %s: %s", realFilepath, err)
|
||||
}
|
||||
// set permissions
|
||||
if runtime.GOOS != "windows" {
|
||||
err = os.Chmod(realFilepath, 0644)
|
||||
if err != nil {
|
||||
log.Warningf("updates: failed to set permissions on downloaded file %s: %s", realFilepath, err)
|
||||
}
|
||||
}
|
||||
|
||||
log.Infof("updates: fetched %s (stored to %s)", downloadURL, realFilepath)
|
||||
return nil
|
||||
|
||||
@@ -56,7 +56,7 @@ func loadOrFetchFile(identifier string) (*File, error) {
|
||||
}
|
||||
|
||||
// build final filepath
|
||||
realFilePath := filepath.Join(updateStoragePath, versionedFilePath)
|
||||
realFilePath := filepath.Join(updateStoragePath, filepath.FromSlash(versionedFilePath))
|
||||
if _, err := os.Stat(realFilePath); err == nil {
|
||||
// file exists
|
||||
updateUsedStatus(identifier, version)
|
||||
|
||||
@@ -92,6 +92,7 @@ func ScanForLatest(baseDir string, hardFail bool) (latest map[string]string, las
|
||||
storedVersion, ok := latest[identifierPath]
|
||||
if ok {
|
||||
// FIXME: this will fail on multi-digit version segments!
|
||||
// FIXME: use https://github.com/hashicorp/go-version
|
||||
if version > storedVersion {
|
||||
latest[identifierPath] = version
|
||||
}
|
||||
|
||||
Reference in New Issue
Block a user